C8H10F5N3 — CID 154162173
2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2,3-diamine (PubChem CID 154162173) has the molecular formula C8H10F5N3 and a molecular weight of 243.18 g/mol. Its IUPAC name is 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2,3-diamine.
| Compound Name | 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 154162173 |
| Molecular Formula | C8H10F5N3 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2,3-diamine |
| SMILES | CC1(N)NC=C(C(F)(F)C(F)(F)F)C=C1N |
| InChI | InChI=1S/C8H10F5N3/c1-6(15)5(14)2-4(3-16-6)7(9,10)8(11,12)13/h2-3,16H,14-15H2,1H3 |
| InChIKey | HDMCACLFDMPOFU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|