About diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate
diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate (PubChem CID 15416320) has the molecular formula C14H17ClO7
and a molecular weight of 332.74 g/mol. Its IUPAC name is diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate |
| PubChem CID | 15416320 |
| Molecular Formula | C14H17ClO7 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1=C(Cl)C(=O)CC12OCCO2 |
| InChI | InChI=1S/C14H17ClO7/c1-3-19-12(17)9(13(18)20-4-2)10-11(15)8(16)7-14(10)21-5-6-22-14/h9H,3-7H2,1-2H3 |
| InChIKey | WOTMLHKFSBESFQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate?
The IUPAC name of diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate (CID 15416320) is diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate.
What is the SMILES notation for diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate?
The canonical SMILES for diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate is CCOC(=O)C(C(=O)OCC)C1=C(Cl)C(=O)CC12OCCO2.
What is the InChIKey of diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate?
The InChIKey is WOTMLHKFSBESFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO7/c1-3-19-12(17)9(13(18)20-4-2)10-11(15)8(16)7-14(10)21-5-6-22-14/h9H,3-7H2,1-2H3.
What are the key properties of diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate?
diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate has a molecular weight of 332.74 g/mol, XLogP of 0.94, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)propanedioate is sourced from PubChem (CID 15416320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).