C20H18F10N2Si2 — CID 15416334
(E)-1,2-bis(2,3,4,5,6-pentafluorophenyl)-N,N'-bis(trimethylsilyl)ethane-1,2-diimine (PubChem CID 15416334) has the molecular formula C20H18F10N2Si2 and a molecular weight of 532.53 g/mol. Its IUPAC name is (E)-1,2-bis(2,3,4,5,6-pentafluorophenyl)-N,N'-bis(trimethylsilyl)ethane-1,2-diimine.
| Compound Name | (E)-1,2-bis(2,3,4,5,6-pentafluorophenyl)-N,N'-bis(trimethylsilyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 15416334 |
| Molecular Formula | C20H18F10N2Si2 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | (E)-1,2-bis(2,3,4,5,6-pentafluorophenyl)-N,N'-bis(trimethylsilyl)ethane-1,2-diimine |
| SMILES | C[Si](C)(C)/N=C(C(=N/[Si](C)(C)C)/c1c(F)c(F)c(F)c(F)c1F)\c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18F10N2Si2/c1-33(2,3)31-19(7-9(21)13(25)17(29)14(26)10(7)22)20(32-34(4,5)6)8-11(23)15(27)18(30)16(28)12(8)24/h1-6H3/b31-19+,32-20+ |
| InChIKey | UGUXDZDTZWCUOL-GKTLAHRSSA-N |
| XLogP | 7.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|