C24H7Br5O8 — CID 154164768
5,6,7,8,9-pentabromoperylene-1,2,3,4-tetracarboxylic acid (PubChem CID 154164768) has the molecular formula C24H7Br5O8 and a molecular weight of 822.83 g/mol. Its IUPAC name is 5,6,7,8,9-pentabromoperylene-1,2,3,4-tetracarboxylic acid.
| Compound Name | 5,6,7,8,9-pentabromoperylene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 154164768 |
| Molecular Formula | C24H7Br5O8 |
| Molecular Weight | 822.83 g/mol |
| Exact Mass | 817.61 |
| IUPAC Name | 5,6,7,8,9-pentabromoperylene-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c2c(C(=O)O)c(Br)c(Br)c3c4c(Br)c(Br)c(Br)c5cccc(c(c1C(=O)O)c23)c54 |
| InChI | InChI=1S/C24H7Br5O8/c25-16-5-3-1-2-4-6(5)10(18(27)20(16)29)11-8-7(4)12(21(30)31)14(23(34)35)13(22(32)33)9(8)15(24(36)37)19(28)17(11)26/h1-3H,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | QCUQEZYWIQULTC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.83 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|