About 5,5-diazido-2-methylcyclohexa-1,3-diene
5,5-diazido-2-methylcyclohexa-1,3-diene (PubChem CID 154165115) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5,5-diazido-2-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,5-diazido-2-methylcyclohexa-1,3-diene |
| PubChem CID | 154165115 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5,5-diazido-2-methylcyclohexa-1,3-diene |
| SMILES | CC1=CCC(N=[N+]=[N-])(N=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C7H8N6/c1-6-2-4-7(5-3-6,10-12-8)11-13-9/h2-4H,5H2,1H3 |
| InChIKey | IRZWRCTWPPUIFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diazido-2-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diazido-2-methylcyclohexa-1,3-diene?
The IUPAC name of 5,5-diazido-2-methylcyclohexa-1,3-diene (CID 154165115) is 5,5-diazido-2-methylcyclohexa-1,3-diene.
What is the SMILES notation for 5,5-diazido-2-methylcyclohexa-1,3-diene?
The canonical SMILES for 5,5-diazido-2-methylcyclohexa-1,3-diene is CC1=CCC(N=[N+]=[N-])(N=[N+]=[N-])C=C1.
What is the InChIKey of 5,5-diazido-2-methylcyclohexa-1,3-diene?
The InChIKey is IRZWRCTWPPUIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6/c1-6-2-4-7(5-3-6,10-12-8)11-13-9/h2-4H,5H2,1H3.
What are the key properties of 5,5-diazido-2-methylcyclohexa-1,3-diene?
5,5-diazido-2-methylcyclohexa-1,3-diene has a molecular weight of 176.18 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diazido-2-methylcyclohexa-1,3-diene is sourced from PubChem (CID 154165115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).