About 3-phenylbut-1-enyl acetate
3-phenylbut-1-enyl acetate (PubChem CID 154165575) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-phenylbut-1-enyl acetate.
Molecular Properties
| Compound Name | 3-phenylbut-1-enyl acetate |
| PubChem CID | 154165575 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-phenylbut-1-enyl acetate |
| SMILES | CC(=O)OC=CC(C)c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-10(8-9-14-11(2)13)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | OOXTUZYASRPMLY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbut-1-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbut-1-enyl acetate?
The IUPAC name of 3-phenylbut-1-enyl acetate (CID 154165575) is 3-phenylbut-1-enyl acetate.
What is the SMILES notation for 3-phenylbut-1-enyl acetate?
The canonical SMILES for 3-phenylbut-1-enyl acetate is CC(=O)OC=CC(C)c1ccccc1.
What is the InChIKey of 3-phenylbut-1-enyl acetate?
The InChIKey is OOXTUZYASRPMLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-10(8-9-14-11(2)13)12-6-4-3-5-7-12/h3-10H,1-2H3.
What are the key properties of 3-phenylbut-1-enyl acetate?
3-phenylbut-1-enyl acetate has a molecular weight of 190.24 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbut-1-enyl acetate is sourced from PubChem (CID 154165575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).