C23H22FN9O3S — CID 154165874
3-[4-amino-1-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol (PubChem CID 154165874) has the molecular formula C23H22FN9O3S and a molecular weight of 523.55 g/mol. Its IUPAC name is 3-[4-amino-1-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol.
| Compound Name | 3-[4-amino-1-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol |
|---|---|
| PubChem CID | 154165874 |
| Molecular Formula | C23H22FN9O3S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 3-[4-amino-1-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-5-fluorophenol |
| SMILES | Cc1ccn2nc(Cn3nc(-c4cc(O)cc(F)c4)c4c(N)ncnc43)nc(N3CCS(=O)(=O)CC3)c12 |
| InChI | InChI=1S/C23H22FN9O3S/c1-13-2-3-32-20(13)23(31-4-6-37(35,36)7-5-31)28-17(29-32)11-33-22-18(21(25)26-12-27-22)19(30-33)14-8-15(24)10-16(34)9-14/h2-3,8-10,12,34H,4-7,11H2,1H3,(H2,25,26,27) |
| InChIKey | GSSLPLJEMOWKRV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |