C16H28O2 — CID 154166177
3-(6-ethoxy-2,6-dimethylheptyl)cyclopent-2-en-1-one (PubChem CID 154166177) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-(6-ethoxy-2,6-dimethylheptyl)cyclopent-2-en-1-one.
| Compound Name | 3-(6-ethoxy-2,6-dimethylheptyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 154166177 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 3-(6-ethoxy-2,6-dimethylheptyl)cyclopent-2-en-1-one |
| SMILES | CCOC(C)(C)CCCC(C)CC1=CC(=O)CC1 |
| InChI | InChI=1S/C16H28O2/c1-5-18-16(3,4)10-6-7-13(2)11-14-8-9-15(17)12-14/h12-13H,5-11H2,1-4H3 |
| InChIKey | XGMYCKPXSHLKHQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |