C4H11NO6S2 — CID 154166868
2-(ethylamino)ethane-1,1-disulfonic acid (PubChem CID 154166868) has the molecular formula C4H11NO6S2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(ethylamino)ethane-1,1-disulfonic acid.
| Compound Name | 2-(ethylamino)ethane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 154166868 |
| Molecular Formula | C4H11NO6S2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 2-(ethylamino)ethane-1,1-disulfonic acid |
| SMILES | CCNCC(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C4H11NO6S2/c1-2-5-3-4(12(6,7)8)13(9,10)11/h4-5H,2-3H2,1H3,(H,6,7,8)(H,9,10,11) |
| InChIKey | UQCYZJDBTFGXQB-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|