C22H29N5O2S2 — CID 154167322
3-(4-tert-butylphenyl)sulfonyl-2,5-dimethyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidine-6-thiol (PubChem CID 154167322) has the molecular formula C22H29N5O2S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-2,5-dimethyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidine-6-thiol.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-2,5-dimethyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidine-6-thiol |
|---|---|
| PubChem CID | 154167322 |
| Molecular Formula | C22H29N5O2S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-2,5-dimethyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidine-6-thiol |
| SMILES | Cc1nc2c(S(=O)(=O)c3ccc(C(C)(C)C)cc3)c(C)nn2c(N2CCNCC2)c1S |
| InChI | InChI=1S/C22H29N5O2S2/c1-14-18(30)21(26-12-10-23-11-13-26)27-20(24-14)19(15(2)25-27)31(28,29)17-8-6-16(7-9-17)22(3,4)5/h6-9,23,30H,10-13H2,1-5H3 |
| InChIKey | RVTKBFMLDOGVLD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|