About (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate
(3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate (PubChem CID 154167556) has the molecular formula C15H24O7
and a molecular weight of 316.35 g/mol. Its IUPAC name is (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate.
Molecular Properties
| Compound Name | (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate |
| PubChem CID | 154167556 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate |
| SMILES | COC1CC(OC(=O)C(OC2CC(O)C2)OC2CCC2O)C1 |
| InChI | InChI=1S/C15H24O7/c1-19-9-6-11(7-9)20-14(18)15(21-10-4-8(16)5-10)22-13-3-2-12(13)17/h8-13,15-17H,2-7H2,1H3 |
| InChIKey | WSOMVXAVCKAVSP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate?
The IUPAC name of (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate (CID 154167556) is (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate.
What is the SMILES notation for (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate?
The canonical SMILES for (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate is COC1CC(OC(=O)C(OC2CC(O)C2)OC2CCC2O)C1.
What is the InChIKey of (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate?
The InChIKey is WSOMVXAVCKAVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O7/c1-19-9-6-11(7-9)20-14(18)15(21-10-4-8(16)5-10)22-13-3-2-12(13)17/h8-13,15-17H,2-7H2,1H3.
What are the key properties of (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate?
(3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate has a molecular weight of 316.35 g/mol, XLogP of 0.11, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxycyclobutyl) 2-(2-hydroxycyclobutyl)oxy-2-(3-hydroxycyclobutyl)oxyacetate is sourced from PubChem (CID 154167556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).