C13H22O2 — CID 15416759
(4S,5R)-4-ethynyl-5-(methoxymethoxy)non-1-ene (PubChem CID 15416759) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4S,5R)-4-ethynyl-5-(methoxymethoxy)non-1-ene.
| Compound Name | (4S,5R)-4-ethynyl-5-(methoxymethoxy)non-1-ene |
|---|---|
| PubChem CID | 15416759 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4S,5R)-4-ethynyl-5-(methoxymethoxy)non-1-ene |
| SMILES | C#C[C@H](CC=C)[C@@H](CCCC)OCOC |
| InChI | InChI=1S/C13H22O2/c1-5-8-10-13(15-11-14-4)12(7-3)9-6-2/h3,6,12-13H,2,5,8-11H2,1,4H3/t12-,13-/m1/s1 |
| InChIKey | DEEGSJONWRNHLX-CHWSQXEVSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|