C40H40O7P2Si2 — CID 154167711
[4-[[(2,3-diphenyl-4-phosphonophenyl)-dimethylsilyl]oxy-dimethylsilyl]-2,3-diphenylphenyl]phosphonic acid (PubChem CID 154167711) has the molecular formula C40H40O7P2Si2 and a molecular weight of 750.87 g/mol. Its IUPAC name is [4-[[(2,3-diphenyl-4-phosphonophenyl)-dimethylsilyl]oxy-dimethylsilyl]-2,3-diphenylphenyl]phosphonic acid.
| Compound Name | [4-[[(2,3-diphenyl-4-phosphonophenyl)-dimethylsilyl]oxy-dimethylsilyl]-2,3-diphenylphenyl]phosphonic acid |
|---|---|
| PubChem CID | 154167711 |
| Molecular Formula | C40H40O7P2Si2 |
| Molecular Weight | 750.87 g/mol |
| Exact Mass | 750.18 |
| IUPAC Name | [4-[[(2,3-diphenyl-4-phosphonophenyl)-dimethylsilyl]oxy-dimethylsilyl]-2,3-diphenylphenyl]phosphonic acid |
| SMILES | C[Si](C)(O[Si](C)(C)c1ccc(P(=O)(O)O)c(-c2ccccc2)c1-c1ccccc1)c1ccc(P(=O)(O)O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C40H40O7P2Si2/c1-50(2,35-27-25-33(48(41,42)43)37(29-17-9-5-10-18-29)39(35)31-21-13-7-14-22-31)47-51(3,4)36-28-26-34(49(44,45)46)38(30-19-11-6-12-20-30)40(36)32-23-15-8-16-24-32/h5-28H,1-4H3,(H2,41,42,43)(H2,44,45,46) |
| InChIKey | ILAMLQVLGIRUQQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.87 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|