C13H19NO6 — CID 15416831
diethyl (E,4Z)-4-[[(2-methoxy-2-oxoethyl)amino]methylidene]pent-2-enedioate (PubChem CID 15416831) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is diethyl (E,4Z)-4-[[(2-methoxy-2-oxoethyl)amino]methylidene]pent-2-enedioate.
| Compound Name | diethyl (E,4Z)-4-[[(2-methoxy-2-oxoethyl)amino]methylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 15416831 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | diethyl (E,4Z)-4-[[(2-methoxy-2-oxoethyl)amino]methylidene]pent-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=C/NCC(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C13H19NO6/c1-4-19-11(15)7-6-10(13(17)20-5-2)8-14-9-12(16)18-3/h6-8,14H,4-5,9H2,1-3H3/b7-6+,10-8- |
| InChIKey | OKSMMIYRIGXVFW-QDJLDCPTSA-N |
| XLogP | 0.32 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|