About [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid
[2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid (PubChem CID 154168710) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid.
Molecular Properties
| Compound Name | [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid |
| PubChem CID | 154168710 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid |
| SMILES | CCNC(=O)CN(C(=O)O)C1(C)C=CC=CC1 |
| InChI | InChI=1S/C12H18N2O3/c1-3-13-10(15)9-14(11(16)17)12(2)7-5-4-6-8-12/h4-7H,3,8-9H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | FDHXIQKSPJCHRM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid?
The IUPAC name of [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid (CID 154168710) is [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid.
What is the SMILES notation for [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid?
The canonical SMILES for [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid is CCNC(=O)CN(C(=O)O)C1(C)C=CC=CC1.
What is the InChIKey of [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid?
The InChIKey is FDHXIQKSPJCHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-3-13-10(15)9-14(11(16)17)12(2)7-5-4-6-8-12/h4-7H,3,8-9H2,1-2H3,(H,13,15)(H,16,17).
What are the key properties of [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid?
[2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid has a molecular weight of 238.29 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethylamino)-2-oxoethyl]-(1-methylcyclohexa-2,4-dien-1-yl)carbamic acid is sourced from PubChem (CID 154168710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).