About 3-butyloxetan-2-one
3-butyloxetan-2-one (PubChem CID 15416889) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-butyloxetan-2-one.
Molecular Properties
| Compound Name | 3-butyloxetan-2-one |
| PubChem CID | 15416889 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 3-butyloxetan-2-one |
| SMILES | CCCCC1COC1=O |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-6-5-9-7(6)8/h6H,2-5H2,1H3 |
| InChIKey | FFZVPXMJDFPNJP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 3-butyloxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyloxetan-2-one?
The IUPAC name of 3-butyloxetan-2-one (CID 15416889) is 3-butyloxetan-2-one.
What is the SMILES notation for 3-butyloxetan-2-one?
The canonical SMILES for 3-butyloxetan-2-one is CCCCC1COC1=O.
What is the InChIKey of 3-butyloxetan-2-one?
The InChIKey is FFZVPXMJDFPNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-2-3-4-6-5-9-7(6)8/h6H,2-5H2,1H3.
What are the key properties of 3-butyloxetan-2-one?
3-butyloxetan-2-one has a molecular weight of 128.17 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyloxetan-2-one is sourced from PubChem (CID 15416889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).