About 4-phosphorosobutan-2-ol
4-phosphorosobutan-2-ol (PubChem CID 154169603) has the molecular formula C4H9O2P
and a molecular weight of 120.09 g/mol. Its IUPAC name is 4-phosphorosobutan-2-ol.
Molecular Properties
| Compound Name | 4-phosphorosobutan-2-ol |
| PubChem CID | 154169603 |
| Molecular Formula | C4H9O2P |
| Molecular Weight | 120.09 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | 4-phosphorosobutan-2-ol |
| SMILES | CC(O)CCP=O |
| InChI | InChI=1S/C4H9O2P/c1-4(5)2-3-7-6/h4-5H,2-3H2,1H3 |
| InChIKey | ZSOBODULQZZMRB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.09 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-phosphorosobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phosphorosobutan-2-ol?
The IUPAC name of 4-phosphorosobutan-2-ol (CID 154169603) is 4-phosphorosobutan-2-ol.
What is the SMILES notation for 4-phosphorosobutan-2-ol?
The canonical SMILES for 4-phosphorosobutan-2-ol is CC(O)CCP=O.
What is the InChIKey of 4-phosphorosobutan-2-ol?
The InChIKey is ZSOBODULQZZMRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2P/c1-4(5)2-3-7-6/h4-5H,2-3H2,1H3.
What are the key properties of 4-phosphorosobutan-2-ol?
4-phosphorosobutan-2-ol has a molecular weight of 120.09 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phosphorosobutan-2-ol is sourced from PubChem (CID 154169603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).