About 4-hexyl-1,3-dihydroimidazole-2-thione
4-hexyl-1,3-dihydroimidazole-2-thione (PubChem CID 154171115) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 4-hexyl-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-hexyl-1,3-dihydroimidazole-2-thione |
| PubChem CID | 154171115 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-hexyl-1,3-dihydroimidazole-2-thione |
| SMILES | CCCCCCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C9H16N2S/c1-2-3-4-5-6-8-7-10-9(12)11-8/h7H,2-6H2,1H3,(H2,10,11,12) |
| InChIKey | SDFFZGORVLAGOY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-hexyl-1,3-dihydroimidazole-2-thione (CID 154171115) is 4-hexyl-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-hexyl-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-hexyl-1,3-dihydroimidazole-2-thione is CCCCCCc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-hexyl-1,3-dihydroimidazole-2-thione?
The InChIKey is SDFFZGORVLAGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-2-3-4-5-6-8-7-10-9(12)11-8/h7H,2-6H2,1H3,(H2,10,11,12).
What are the key properties of 4-hexyl-1,3-dihydroimidazole-2-thione?
4-hexyl-1,3-dihydroimidazole-2-thione has a molecular weight of 184.31 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 154171115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).