About 3-propyl-1H-isochromene
3-propyl-1H-isochromene (PubChem CID 15417197) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-propyl-1H-isochromene.
Molecular Properties
| Compound Name | 3-propyl-1H-isochromene |
| PubChem CID | 15417197 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-propyl-1H-isochromene |
| SMILES | CCCC1=Cc2ccccc2CO1 |
| InChI | InChI=1S/C12H14O/c1-2-5-12-8-10-6-3-4-7-11(10)9-13-12/h3-4,6-8H,2,5,9H2,1H3 |
| InChIKey | MBRRXAFBJUWBGZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propyl-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1H-isochromene?
The IUPAC name of 3-propyl-1H-isochromene (CID 15417197) is 3-propyl-1H-isochromene.
What is the SMILES notation for 3-propyl-1H-isochromene?
The canonical SMILES for 3-propyl-1H-isochromene is CCCC1=Cc2ccccc2CO1.
What is the InChIKey of 3-propyl-1H-isochromene?
The InChIKey is MBRRXAFBJUWBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c1-2-5-12-8-10-6-3-4-7-11(10)9-13-12/h3-4,6-8H,2,5,9H2,1H3.
What are the key properties of 3-propyl-1H-isochromene?
3-propyl-1H-isochromene has a molecular weight of 174.24 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1H-isochromene is sourced from PubChem (CID 15417197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).