C23H18S4 — CID 15417471
4,5-dimethyl-2-[10-(4-methyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-1,3-dithiole (PubChem CID 15417471) has the molecular formula C23H18S4 and a molecular weight of 422.67 g/mol. Its IUPAC name is 4,5-dimethyl-2-[10-(4-methyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-1,3-dithiole.
| Compound Name | 4,5-dimethyl-2-[10-(4-methyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-1,3-dithiole |
|---|---|
| PubChem CID | 15417471 |
| Molecular Formula | C23H18S4 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4,5-dimethyl-2-[10-(4-methyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-1,3-dithiole |
| SMILES | CC1=CSC(=c2c3ccccc3c(=C3SC(C)=C(C)S3)c3ccccc23)S1 |
| InChI | InChI=1S/C23H18S4/c1-13-12-24-22(25-13)20-16-8-4-6-10-18(16)21(19-11-7-5-9-17(19)20)23-26-14(2)15(3)27-23/h4-12H,1-3H3 |
| InChIKey | PALGOWXSAQLTJL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|