About 2-tert-butyl-5,10-dioxidophenazine-5,10-diium
2-tert-butyl-5,10-dioxidophenazine-5,10-diium (PubChem CID 154175105) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-tert-butyl-5,10-dioxidophenazine-5,10-diium.
Molecular Properties
| Compound Name | 2-tert-butyl-5,10-dioxidophenazine-5,10-diium |
| PubChem CID | 154175105 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-tert-butyl-5,10-dioxidophenazine-5,10-diium |
| SMILES | CC(C)(C)c1ccc2c(c1)[n+]([O-])c1ccccc1[n+]2[O-] |
| InChI | InChI=1S/C16H16N2O2/c1-16(2,3)11-8-9-14-15(10-11)18(20)13-7-5-4-6-12(13)17(14)19/h4-10H,1-3H3 |
| InChIKey | VVDWVMNVGOCQLM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5,10-dioxidophenazine-5,10-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,10-dioxidophenazine-5,10-diium?
The IUPAC name of 2-tert-butyl-5,10-dioxidophenazine-5,10-diium (CID 154175105) is 2-tert-butyl-5,10-dioxidophenazine-5,10-diium.
What is the SMILES notation for 2-tert-butyl-5,10-dioxidophenazine-5,10-diium?
The canonical SMILES for 2-tert-butyl-5,10-dioxidophenazine-5,10-diium is CC(C)(C)c1ccc2c(c1)[n+]([O-])c1ccccc1[n+]2[O-].
What is the InChIKey of 2-tert-butyl-5,10-dioxidophenazine-5,10-diium?
The InChIKey is VVDWVMNVGOCQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-16(2,3)11-8-9-14-15(10-11)18(20)13-7-5-4-6-12(13)17(14)19/h4-10H,1-3H3.
What are the key properties of 2-tert-butyl-5,10-dioxidophenazine-5,10-diium?
2-tert-butyl-5,10-dioxidophenazine-5,10-diium has a molecular weight of 268.32 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,10-dioxidophenazine-5,10-diium is sourced from PubChem (CID 154175105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).