C11H9F3O4-2 — CID 154175777
1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylate (PubChem CID 154175777) has the molecular formula C11H9F3O4-2 and a molecular weight of 262.18 g/mol. Its IUPAC name is 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylate.
| Compound Name | 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 154175777 |
| Molecular Formula | C11H9F3O4-2 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1,4-dimethyl-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dicarboxylate |
| SMILES | CC1(C(=O)[O-])C=CC(C)(C(=O)[O-])C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C11H11F3O4/c1-9(7(15)16)3-4-10(2,8(17)18)6(5-9)11(12,13)14/h3-5H,1-2H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | UQTQYVVPLFXEFW-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|