C14H22O2Si — CID 154176265
2-[(2-methoxy-6,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-3,4-dihydro-2H-oxasiline (PubChem CID 154176265) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-[(2-methoxy-6,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-3,4-dihydro-2H-oxasiline.
| Compound Name | 2-[(2-methoxy-6,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-3,4-dihydro-2H-oxasiline |
|---|---|
| PubChem CID | 154176265 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[(2-methoxy-6,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-3,4-dihydro-2H-oxasiline |
| SMILES | COC1=CC=CC(C)(C)C1C[SiH]1CCC=CO1 |
| InChI | InChI=1S/C14H22O2Si/c1-14(2)8-6-7-13(15-3)12(14)11-17-10-5-4-9-16-17/h4,6-9,12,17H,5,10-11H2,1-3H3 |
| InChIKey | VYFWAZROGILFKB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|