About (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate
(4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate (PubChem CID 154178498) has the molecular formula C11H14F2O2
and a molecular weight of 216.23 g/mol. Its IUPAC name is (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate |
| PubChem CID | 154178498 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate |
| SMILES | CCCC(=O)OCC1=CCC(F)(F)C=C1 |
| InChI | InChI=1S/C11H14F2O2/c1-2-3-10(14)15-8-9-4-6-11(12,13)7-5-9/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | JIEILKWQYVIUEV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate?
The IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate (CID 154178498) is (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate.
What is the SMILES notation for (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate?
The canonical SMILES for (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate is CCCC(=O)OCC1=CCC(F)(F)C=C1.
What is the InChIKey of (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate?
The InChIKey is JIEILKWQYVIUEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O2/c1-2-3-10(14)15-8-9-4-6-11(12,13)7-5-9/h4-6H,2-3,7-8H2,1H3.
What are the key properties of (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate?
(4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate has a molecular weight of 216.23 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexa-1,5-dien-1-yl)methyl butanoate is sourced from PubChem (CID 154178498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).