C20H14O4S4 — CID 15417852
7-thiophen-2-yl-5-(7-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 15417852) has the molecular formula C20H14O4S4 and a molecular weight of 446.60 g/mol. Its IUPAC name is 7-thiophen-2-yl-5-(7-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 7-thiophen-2-yl-5-(7-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 15417852 |
| Molecular Formula | C20H14O4S4 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 7-thiophen-2-yl-5-(7-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1csc(-c2sc(-c3sc(-c4cccs4)c4c3OCCO4)c3c2OCCO3)c1 |
| InChI | InChI=1S/C20H14O4S4/c1-3-11(25-9-1)17-13-15(23-7-5-21-13)19(27-17)20-16-14(22-6-8-24-16)18(28-20)12-4-2-10-26-12/h1-4,9-10H,5-8H2 |
| InChIKey | QPSOIVWKAJCVBM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |