C5H3F7O2 — CID 154178612
1,1,1,3,3,4,4-heptafluoro-4-methoxybutan-2-one (PubChem CID 154178612) has the molecular formula C5H3F7O2 and a molecular weight of 228.06 g/mol. Its IUPAC name is 1,1,1,3,3,4,4-heptafluoro-4-methoxybutan-2-one.
| Compound Name | 1,1,1,3,3,4,4-heptafluoro-4-methoxybutan-2-one |
|---|---|
| PubChem CID | 154178612 |
| Molecular Formula | C5H3F7O2 |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 1,1,1,3,3,4,4-heptafluoro-4-methoxybutan-2-one |
| SMILES | COC(F)(F)C(F)(F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C5H3F7O2/c1-14-5(11,12)3(6,7)2(13)4(8,9)10/h1H3 |
| InChIKey | HJYIWBTWTXRSHW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|