C19H30Br2O — CID 154179210
(8R,9S,10R,13S,14S,17S)-2,4-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 154179210) has the molecular formula C19H30Br2O and a molecular weight of 434.26 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-2,4-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10R,13S,14S,17S)-2,4-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 154179210 |
| Molecular Formula | C19H30Br2O |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-2,4-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4C(Br)CC(Br)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H30Br2O/c1-18-8-7-14-12(13(18)5-6-17(18)22)3-4-15-16(21)9-11(20)10-19(14,15)2/h11-17,22H,3-10H2,1-2H3/t11?,12-,13-,14-,15?,16?,17-,18-,19+/m0/s1 |
| InChIKey | YXWNJGJYPDHSQL-HWUVEGHASA-N |
| XLogP | 5.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|