C29H49NO3Sn — CID 15417934
(3aS,4S,5E,6S,6aR)-N-benzyl-4-methoxy-2,2-dimethyl-5-(tributylstannylmethylidene)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-amine (PubChem CID 15417934) has the molecular formula C29H49NO3Sn and a molecular weight of 578.43 g/mol. Its IUPAC name is (3aS,4S,5E,6S,6aR)-N-benzyl-4-methoxy-2,2-dimethyl-5-(tributylstannylmethylidene)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-amine.
| Compound Name | (3aS,4S,5E,6S,6aR)-N-benzyl-4-methoxy-2,2-dimethyl-5-(tributylstannylmethylidene)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-amine |
|---|---|
| PubChem CID | 15417934 |
| Molecular Formula | C29H49NO3Sn |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | (3aS,4S,5E,6S,6aR)-N-benzyl-4-methoxy-2,2-dimethyl-5-(tributylstannylmethylidene)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-amine |
| SMILES | CCCC[Sn](/C=C1\[C@H](NCc2ccccc2)[C@H]2OC(C)(C)O[C@H]2[C@H]1OC)(CCCC)CCCC |
| InChI | InChI=1S/C17H22NO3.3C4H9.Sn/c1-11-13(18-10-12-8-6-5-7-9-12)15-16(14(11)19-4)21-17(2,3)20-15;3*1-3-4-2;/h1,5-9,13-16,18H,10H2,2-4H3;3*1,3-4H2,2H3;/t13-,14-,15+,16-;;;;/m0..../s1 |
| InChIKey | QQJMYEUNYPANFX-FDAHKYQHSA-N |
| XLogP | 7.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |