C22H24F3NO3 — CID 154179479
ethyl 2-(1-methylpyrrolidin-3-yl)oxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 154179479) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is ethyl 2-(1-methylpyrrolidin-3-yl)oxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-(1-methylpyrrolidin-3-yl)oxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 154179479 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 2-(1-methylpyrrolidin-3-yl)oxy-2-phenyl-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(OC1CCN(C)C1)(c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F3NO3/c1-3-28-20(27)21(16-8-5-4-6-9-16,29-19-12-13-26(2)15-19)17-10-7-11-18(14-17)22(23,24)25/h4-11,14,19H,3,12-13,15H2,1-2H3 |
| InChIKey | GBDPIHGWVXQFCE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |