C23H30O5 — CID 154180149
1,5-bis(2-hydroxy-5-propan-2-yloxyphenyl)pentan-3-one (PubChem CID 154180149) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1,5-bis(2-hydroxy-5-propan-2-yloxyphenyl)pentan-3-one.
| Compound Name | 1,5-bis(2-hydroxy-5-propan-2-yloxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 154180149 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1,5-bis(2-hydroxy-5-propan-2-yloxyphenyl)pentan-3-one |
| SMILES | CC(C)Oc1ccc(O)c(CCC(=O)CCc2cc(OC(C)C)ccc2O)c1 |
| InChI | InChI=1S/C23H30O5/c1-15(2)27-20-9-11-22(25)17(13-20)5-7-19(24)8-6-18-14-21(28-16(3)4)10-12-23(18)26/h9-16,25-26H,5-8H2,1-4H3 |
| InChIKey | JQWRHCRWNACDKX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |