C17H27NOSi — CID 15418143
1-[(4S,5R)-4-[dimethyl(phenyl)silyl]-2,2,5-trimethylpyrrolidin-1-yl]ethanone (PubChem CID 15418143) has the molecular formula C17H27NOSi and a molecular weight of 289.49 g/mol. Its IUPAC name is 1-[(4S,5R)-4-[dimethyl(phenyl)silyl]-2,2,5-trimethylpyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(4S,5R)-4-[dimethyl(phenyl)silyl]-2,2,5-trimethylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 15418143 |
| Molecular Formula | C17H27NOSi |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[(4S,5R)-4-[dimethyl(phenyl)silyl]-2,2,5-trimethylpyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](C)[C@@H]([Si](C)(C)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C17H27NOSi/c1-13-16(12-17(3,4)18(13)14(2)19)20(5,6)15-10-8-7-9-11-15/h7-11,13,16H,12H2,1-6H3/t13-,16+/m1/s1 |
| InChIKey | GUAUWDJANLKSDF-CJNGLKHVSA-N |
| XLogP | 3.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|