About 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol
4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol (PubChem CID 154181431) has the molecular formula C7H8Cl2OS
and a molecular weight of 211.11 g/mol. Its IUPAC name is 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 154181431 |
| Molecular Formula | C7H8Cl2OS |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol |
| SMILES | CSC1(O)C=CC(Cl)=C(Cl)C1 |
| InChI | InChI=1S/C7H8Cl2OS/c1-11-7(10)3-2-5(8)6(9)4-7/h2-3,10H,4H2,1H3 |
| InChIKey | FWVDIIXTWCBWCI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol (CID 154181431) is 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol is CSC1(O)C=CC(Cl)=C(Cl)C1.
What is the InChIKey of 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol?
The InChIKey is FWVDIIXTWCBWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2OS/c1-11-7(10)3-2-5(8)6(9)4-7/h2-3,10H,4H2,1H3.
What are the key properties of 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol?
4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol has a molecular weight of 211.11 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-1-methylsulfanylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 154181431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).