About 3-trityl-1,2-dihydroimidazole
3-trityl-1,2-dihydroimidazole (PubChem CID 154182196) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-trityl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-trityl-1,2-dihydroimidazole |
| PubChem CID | 154182196 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-trityl-1,2-dihydroimidazole |
| SMILES | C1=CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C22H20N2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,23H,18H2 |
| InChIKey | DKXYDXLPJCZAOW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-trityl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trityl-1,2-dihydroimidazole?
The IUPAC name of 3-trityl-1,2-dihydroimidazole (CID 154182196) is 3-trityl-1,2-dihydroimidazole.
What is the SMILES notation for 3-trityl-1,2-dihydroimidazole?
The canonical SMILES for 3-trityl-1,2-dihydroimidazole is C1=CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CN1.
What is the InChIKey of 3-trityl-1,2-dihydroimidazole?
The InChIKey is DKXYDXLPJCZAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,23H,18H2.
What are the key properties of 3-trityl-1,2-dihydroimidazole?
3-trityl-1,2-dihydroimidazole has a molecular weight of 312.42 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trityl-1,2-dihydroimidazole is sourced from PubChem (CID 154182196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).