About 2-benzyl-3H-1,2-thiazole 1,1-dioxide
2-benzyl-3H-1,2-thiazole 1,1-dioxide (PubChem CID 15418398) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-benzyl-3H-1,2-thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 2-benzyl-3H-1,2-thiazole 1,1-dioxide |
| PubChem CID | 15418398 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-benzyl-3H-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C=CCN1Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO2S/c12-14(13)8-4-7-11(14)9-10-5-2-1-3-6-10/h1-6,8H,7,9H2 |
| InChIKey | KUEHWGCXQUBWQI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3H-1,2-thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3H-1,2-thiazole 1,1-dioxide?
The IUPAC name of 2-benzyl-3H-1,2-thiazole 1,1-dioxide (CID 15418398) is 2-benzyl-3H-1,2-thiazole 1,1-dioxide.
What is the SMILES notation for 2-benzyl-3H-1,2-thiazole 1,1-dioxide?
The canonical SMILES for 2-benzyl-3H-1,2-thiazole 1,1-dioxide is O=S1(=O)C=CCN1Cc1ccccc1.
What is the InChIKey of 2-benzyl-3H-1,2-thiazole 1,1-dioxide?
The InChIKey is KUEHWGCXQUBWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c12-14(13)8-4-7-11(14)9-10-5-2-1-3-6-10/h1-6,8H,7,9H2.
What are the key properties of 2-benzyl-3H-1,2-thiazole 1,1-dioxide?
2-benzyl-3H-1,2-thiazole 1,1-dioxide has a molecular weight of 209.27 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3H-1,2-thiazole 1,1-dioxide is sourced from PubChem (CID 15418398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).