C18H15ClF3NO — CID 154184004
1-(2-chlorophenyl)-4-(methylamino)-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one (PubChem CID 154184004) has the molecular formula C18H15ClF3NO and a molecular weight of 353.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(methylamino)-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one.
| Compound Name | 1-(2-chlorophenyl)-4-(methylamino)-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 154184004 |
| Molecular Formula | C18H15ClF3NO |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(methylamino)-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one |
| SMILES | CNC=C(C(=O)Cc1ccccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15ClF3NO/c1-23-11-15(12-6-4-7-14(9-12)18(20,21)22)17(24)10-13-5-2-3-8-16(13)19/h2-9,11,23H,10H2,1H3 |
| InChIKey | CMTPLNCNLCCVTA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|