About 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine
1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine (PubChem CID 154184213) has the molecular formula C13H16ClN
and a molecular weight of 221.73 g/mol. Its IUPAC name is 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine |
| PubChem CID | 154184213 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine |
| SMILES | CNCC1C=Cc2cccc(Cl)c2CC1 |
| InChI | InChI=1S/C13H16ClN/c1-15-9-10-5-7-11-3-2-4-13(14)12(11)8-6-10/h2-5,7,10,15H,6,8-9H2,1H3 |
| InChIKey | ZWAVVQCBQLJSME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine?
The IUPAC name of 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine (CID 154184213) is 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine?
The canonical SMILES for 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine is CNCC1C=Cc2cccc(Cl)c2CC1.
What is the InChIKey of 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine?
The InChIKey is ZWAVVQCBQLJSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN/c1-15-9-10-5-7-11-3-2-4-13(14)12(11)8-6-10/h2-5,7,10,15H,6,8-9H2,1H3.
What are the key properties of 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine?
1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine has a molecular weight of 221.73 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-chloro-8,9-dihydro-7H-benzo[7]annulen-7-yl)-N-methylmethanamine is sourced from PubChem (CID 154184213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).