C27H46N6 — CID 154184288
2-N,2-N,10-N,10-N,12,18-hexamethyl-13,17,20,24-tetrazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene-2,10-diamine (PubChem CID 154184288) has the molecular formula C27H46N6 and a molecular weight of 454.71 g/mol. Its IUPAC name is 2-N,2-N,10-N,10-N,12,18-hexamethyl-13,17,20,24-tetrazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene-2,10-diamine.
| Compound Name | 2-N,2-N,10-N,10-N,12,18-hexamethyl-13,17,20,24-tetrazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene-2,10-diamine |
|---|---|
| PubChem CID | 154184288 |
| Molecular Formula | C27H46N6 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 2-N,2-N,10-N,10-N,12,18-hexamethyl-13,17,20,24-tetrazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene-2,10-diamine |
| SMILES | C/C1=N/CCC/N=C(\C)C2=C(N(C)C)CCCCCCCC(N(C)C)=C1/C=N\CCC/N=C/2 |
| InChI | InChI=1S/C27H46N6/c1-22-24-20-28-16-12-17-29-21-25(23(2)31-19-13-18-30-22)27(33(5)6)15-11-9-7-8-10-14-26(24)32(3)4/h20-21H,7-19H2,1-6H3/b26-24?,27-25?,28-20-,29-21+,30-22-,31-23+ |
| InChIKey | DEWKOBZWVUPCRV-DUCDYIAZSA-N |
| XLogP | 5.22 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |