C16H13N3S — CID 15418483
N-benzyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 15418483) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-benzyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | N-benzyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 15418483 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-benzyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | c1ccc(CNc2nc3ccsc3n3cccc23)cc1 |
| InChI | InChI=1S/C16H13N3S/c1-2-5-12(6-3-1)11-17-15-14-7-4-9-19(14)16-13(18-15)8-10-20-16/h1-10H,11H2,(H,17,18) |
| InChIKey | WZGHBLAMTRQSQW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |