C13H18O4 — CID 15418709
(1S,4S,7S)-7-acetyl-3,3-dimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 15418709) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1S,4S,7S)-7-acetyl-3,3-dimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4S,7S)-7-acetyl-3,3-dimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 15418709 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1S,4S,7S)-7-acetyl-3,3-dimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(C)[C@@H]1C[C@@H]2C(C)=O |
| InChI | InChI=1S/C13H18O4/c1-7-5-10-9(8(2)14)6-11(7)13(16-3,17-4)12(10)15/h5,9-11H,6H2,1-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | XMBAOFCYZAMBDQ-VWYCJHECSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|