C14H18O6 — CID 15418713
methyl (1R,4S,7S)-7-acetyl-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate (PubChem CID 15418713) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is methyl (1R,4S,7S)-7-acetyl-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate.
| Compound Name | methyl (1R,4S,7S)-7-acetyl-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15418713 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl (1R,4S,7S)-7-acetyl-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C[C@H](C(C)=O)[C@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C14H18O6/c1-7(15)9-5-8-6-10(13(17)18-2)11(9)12(16)14(8,19-3)20-4/h6,8-9,11H,5H2,1-4H3/t8-,9+,11+/m0/s1 |
| InChIKey | AIZQYOYRAUAEIR-IQJOONFLSA-N |
| XLogP | 0.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|