C21H24O2 — CID 15418788
1-[(E)-2-[(1S,2S,3R)-3-ethenyl-2-(methoxymethoxy)cyclopentyl]ethenyl]naphthalene (PubChem CID 15418788) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[(E)-2-[(1S,2S,3R)-3-ethenyl-2-(methoxymethoxy)cyclopentyl]ethenyl]naphthalene.
| Compound Name | 1-[(E)-2-[(1S,2S,3R)-3-ethenyl-2-(methoxymethoxy)cyclopentyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 15418788 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[(E)-2-[(1S,2S,3R)-3-ethenyl-2-(methoxymethoxy)cyclopentyl]ethenyl]naphthalene |
| SMILES | C=C[C@H]1CC[C@@H](/C=C/c2cccc3ccccc23)[C@H]1OCOC |
| InChI | InChI=1S/C21H24O2/c1-3-16-11-13-19(21(16)23-15-22-2)14-12-18-9-6-8-17-7-4-5-10-20(17)18/h3-10,12,14,16,19,21H,1,11,13,15H2,2H3/b14-12+/t16-,19-,21-/m0/s1 |
| InChIKey | VZBOJOXCJJFQRZ-WXYBZZACSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|