About 3-oxopropyl 2-hydroxypropanoate
3-oxopropyl 2-hydroxypropanoate (PubChem CID 154189080) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 3-oxopropyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 3-oxopropyl 2-hydroxypropanoate |
| PubChem CID | 154189080 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 3-oxopropyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCC=O |
| InChI | InChI=1S/C6H10O4/c1-5(8)6(9)10-4-2-3-7/h3,5,8H,2,4H2,1H3 |
| InChIKey | YLUDQNIDRAFIBH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopropyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopropyl 2-hydroxypropanoate?
The IUPAC name of 3-oxopropyl 2-hydroxypropanoate (CID 154189080) is 3-oxopropyl 2-hydroxypropanoate.
What is the SMILES notation for 3-oxopropyl 2-hydroxypropanoate?
The canonical SMILES for 3-oxopropyl 2-hydroxypropanoate is CC(O)C(=O)OCCC=O.
What is the InChIKey of 3-oxopropyl 2-hydroxypropanoate?
The InChIKey is YLUDQNIDRAFIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-5(8)6(9)10-4-2-3-7/h3,5,8H,2,4H2,1H3.
What are the key properties of 3-oxopropyl 2-hydroxypropanoate?
3-oxopropyl 2-hydroxypropanoate has a molecular weight of 146.14 g/mol, XLogP of -0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopropyl 2-hydroxypropanoate is sourced from PubChem (CID 154189080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).