About 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine
4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine (PubChem CID 154189850) has the molecular formula C14H24FN5
and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine |
| PubChem CID | 154189850 |
| Molecular Formula | C14H24FN5 |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine |
| SMILES | CC1CC(C2(N)N=C(N)NC=C2F)CC(C)N1C1CC1 |
| InChI | InChI=1S/C14H24FN5/c1-8-5-10(6-9(2)20(8)11-3-4-11)14(17)12(15)7-18-13(16)19-14/h7-11H,3-6,17H2,1-2H3,(H3,16,18,19) |
| InChIKey | GCBQIFKNDPMOIF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine?
The IUPAC name of 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine (CID 154189850) is 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine is CC1CC(C2(N)N=C(N)NC=C2F)CC(C)N1C1CC1.
What is the InChIKey of 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine?
The InChIKey is GCBQIFKNDPMOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24FN5/c1-8-5-10(6-9(2)20(8)11-3-4-11)14(17)12(15)7-18-13(16)19-14/h7-11H,3-6,17H2,1-2H3,(H3,16,18,19).
What are the key properties of 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine?
4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine has a molecular weight of 281.38 g/mol, XLogP of 1.02, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-cyclopropyl-2,6-dimethylpiperidin-4-yl)-5-fluoro-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 154189850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).