About 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol
2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol (PubChem CID 154191108) has the molecular formula C13H14N4O5
and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol |
| PubChem CID | 154191108 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ccc(NC(CO)CO)nn2)o1 |
| InChI | InChI=1S/C13H14N4O5/c18-7-10(8-19)14-12-5-2-9(15-16-12)1-3-11-4-6-13(22-11)17(20)21/h1-6,10,18-19H,7-8H2,(H,14,16) |
| InChIKey | JCSVSMGREWVVKS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol?
The IUPAC name of 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol (CID 154191108) is 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol.
What is the SMILES notation for 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol?
The canonical SMILES for 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol is O=[N+]([O-])c1ccc(C=Cc2ccc(NC(CO)CO)nn2)o1.
What is the InChIKey of 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol?
The InChIKey is JCSVSMGREWVVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O5/c18-7-10(8-19)14-12-5-2-9(15-16-12)1-3-11-4-6-13(22-11)17(20)21/h1-6,10,18-19H,7-8H2,(H,14,16).
What are the key properties of 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol?
2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol has a molecular weight of 306.28 g/mol, XLogP of 0.91, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-[2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]amino]propane-1,3-diol is sourced from PubChem (CID 154191108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).