About 2-nitrosopyrimidine-4,6-diamine
2-nitrosopyrimidine-4,6-diamine (PubChem CID 154192372) has the molecular formula C4H5N5O
and a molecular weight of 139.12 g/mol. Its IUPAC name is 2-nitrosopyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-nitrosopyrimidine-4,6-diamine |
| PubChem CID | 154192372 |
| Molecular Formula | C4H5N5O |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 2-nitrosopyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(N=O)n1 |
| InChI | InChI=1S/C4H5N5O/c5-2-1-3(6)8-4(7-2)9-10/h1H,(H4,5,6,7,8) |
| InChIKey | JHDHFHGEWIBGNB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-nitrosopyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosopyrimidine-4,6-diamine?
The IUPAC name of 2-nitrosopyrimidine-4,6-diamine (CID 154192372) is 2-nitrosopyrimidine-4,6-diamine.
What is the SMILES notation for 2-nitrosopyrimidine-4,6-diamine?
The canonical SMILES for 2-nitrosopyrimidine-4,6-diamine is Nc1cc(N)nc(N=O)n1.
What is the InChIKey of 2-nitrosopyrimidine-4,6-diamine?
The InChIKey is JHDHFHGEWIBGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O/c5-2-1-3(6)8-4(7-2)9-10/h1H,(H4,5,6,7,8).
What are the key properties of 2-nitrosopyrimidine-4,6-diamine?
2-nitrosopyrimidine-4,6-diamine has a molecular weight of 139.12 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosopyrimidine-4,6-diamine is sourced from PubChem (CID 154192372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).