C10H3F6NO — CID 154192713
3,4,5,6,7,8-hexafluoro-2-methylisoquinolin-1-one (PubChem CID 154192713) has the molecular formula C10H3F6NO and a molecular weight of 267.13 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexafluoro-2-methylisoquinolin-1-one.
| Compound Name | 3,4,5,6,7,8-hexafluoro-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 154192713 |
| Molecular Formula | C10H3F6NO |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3,4,5,6,7,8-hexafluoro-2-methylisoquinolin-1-one |
| SMILES | Cn1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C10H3F6NO/c1-17-9(16)6(13)2-3(10(17)18)5(12)8(15)7(14)4(2)11/h1H3 |
| InChIKey | ACVSVCWPQNRRDF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|