C14H23NO4 — CID 154193909
[(1S,3R)-3-methyl-1-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]hept-6-enyl]carbamic acid (PubChem CID 154193909) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [(1S,3R)-3-methyl-1-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]hept-6-enyl]carbamic acid.
| Compound Name | [(1S,3R)-3-methyl-1-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]hept-6-enyl]carbamic acid |
|---|---|
| PubChem CID | 154193909 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [(1S,3R)-3-methyl-1-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]hept-6-enyl]carbamic acid |
| SMILES | C=CCC[C@@H](C)C[C@H](NC(=O)O)[C@@H]1C[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C14H23NO4/c1-4-5-6-9(2)7-11(15-14(17)18)12-8-10(3)13(16)19-12/h4,9-12,15H,1,5-8H2,2-3H3,(H,17,18)/t9-,10-,11+,12+/m1/s1 |
| InChIKey | XBVYTCFFRWMJMR-WYUUTHIRSA-N |
| XLogP | 2.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|