C17H31FOSi — CID 15419447
1-[(2R,3aS,7aS)-2-[fluoro-di(propan-2-yl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone (PubChem CID 15419447) has the molecular formula C17H31FOSi and a molecular weight of 298.52 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-2-[fluoro-di(propan-2-yl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-2-[fluoro-di(propan-2-yl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
|---|---|
| PubChem CID | 15419447 |
| Molecular Formula | C17H31FOSi |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-[(2R,3aS,7aS)-2-[fluoro-di(propan-2-yl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C[C@@H]([Si](F)(C(C)C)C(C)C)C2 |
| InChI | InChI=1S/C17H31FOSi/c1-12(2)20(18,13(3)4)16-10-15-8-6-7-9-17(15,11-16)14(5)19/h12-13,15-16H,6-11H2,1-5H3/t15-,16+,17+/m0/s1 |
| InChIKey | WWMHFPCNNRLVDN-GVDBMIGSSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|