C19H20N2S — CID 154194483
N-[(4,5-diphenyl-1,3-thiazol-2-yl)methyl]propan-2-amine (PubChem CID 154194483) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-[(4,5-diphenyl-1,3-thiazol-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(4,5-diphenyl-1,3-thiazol-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 154194483 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[(4,5-diphenyl-1,3-thiazol-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H20N2S/c1-14(2)20-13-17-21-18(15-9-5-3-6-10-15)19(22-17)16-11-7-4-8-12-16/h3-12,14,20H,13H2,1-2H3 |
| InChIKey | OICRSQAQLRTQIV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |