C12H20F2OSi — CID 15419453
1-[(2R,3aS,7aS)-2-[difluoro(methyl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone (PubChem CID 15419453) has the molecular formula C12H20F2OSi and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-2-[difluoro(methyl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-2-[difluoro(methyl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
|---|---|
| PubChem CID | 15419453 |
| Molecular Formula | C12H20F2OSi |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-[(2R,3aS,7aS)-2-[difluoro(methyl)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C[C@@H]([Si](C)(F)F)C2 |
| InChI | InChI=1S/C12H20F2OSi/c1-9(15)12-6-4-3-5-10(12)7-11(8-12)16(2,13)14/h10-11H,3-8H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | GAUQHFRHVZLSPW-QJPTWQEYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|